C14H11ClF2N4 — CID 137374233
6-chloro-5-[1-[(2,2-difluoro-1-methylcyclopropyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile (PubChem CID 137374233) has the molecular formula C14H11ClF2N4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 6-chloro-5-[1-[(2,2-difluoro-1-methylcyclopropyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile.
| Compound Name | 6-chloro-5-[1-[(2,2-difluoro-1-methylcyclopropyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 137374233 |
| Molecular Formula | C14H11ClF2N4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 6-chloro-5-[1-[(2,2-difluoro-1-methylcyclopropyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
| SMILES | CC1(Cn2cc(-c3ccc(C#N)nc3Cl)cn2)CC1(F)F |
| InChI | InChI=1S/C14H11ClF2N4/c1-13(7-14(13,16)17)8-21-6-9(5-19-21)11-3-2-10(4-18)20-12(11)15/h2-3,5-6H,7-8H2,1H3 |
| InChIKey | UAEVNHWJCZBYCY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|