C15H13ClF2N4 — CID 137391908
6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile (PubChem CID 137391908) has the molecular formula C15H13ClF2N4 and a molecular weight of 322.75 g/mol. Its IUPAC name is 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile.
| Compound Name | 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 137391908 |
| Molecular Formula | C15H13ClF2N4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2cnn(CC3C[C@@H](F)[C@H](F)C3)c2)c(Cl)n1 |
| InChI | InChI=1S/C15H13ClF2N4/c16-15-12(2-1-11(5-19)21-15)10-6-20-22(8-10)7-9-3-13(17)14(18)4-9/h1-2,6,8-9,13-14H,3-4,7H2/t13-,14-/m1/s1 |
| InChIKey | ZNEIVCONDGNISE-ZIAGYGMSSA-N |
| XLogP | 3.56 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|