About 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile
6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile (PubChem CID 137391908) has the molecular formula C15H13ClF2N4
and a molecular weight of 322.75 g/mol. Its IUPAC name is 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
| PubChem CID | 137391908 |
| Molecular Formula | C15H13ClF2N4 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2cnn(CC3C[C@@H](F)[C@H](F)C3)c2)c(Cl)n1 |
| InChI | InChI=1S/C15H13ClF2N4/c16-15-12(2-1-11(5-19)21-15)10-6-20-22(8-10)7-9-3-13(17)14(18)4-9/h1-2,6,8-9,13-14H,3-4,7H2/t13-,14-/m1/s1 |
| InChIKey | ZNEIVCONDGNISE-ZIAGYGMSSA-N |
| XLogP | 3.56 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile?
The IUPAC name of 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile (CID 137391908) is 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile.
What is the SMILES notation for 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile?
The canonical SMILES for 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile is N#Cc1ccc(-c2cnn(CC3C[C@@H](F)[C@H](F)C3)c2)c(Cl)n1.
What is the InChIKey of 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile?
The InChIKey is ZNEIVCONDGNISE-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H13ClF2N4/c16-15-12(2-1-11(5-19)21-15)10-6-20-22(8-10)7-9-3-13(17)14(18)4-9/h1-2,6,8-9,13-14H,3-4,7H2/t13-,14-/m1/s1.
What are the key properties of 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile?
6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile has a molecular weight of 322.75 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-[1-[[(3R,4R)-3,4-difluorocyclopentyl]methyl]pyrazol-4-yl]pyridine-2-carbonitrile is sourced from PubChem (CID 137391908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).