C14H13ClN4O2 — CID 137373955
6-chloro-5-[1-[(1,3-dihydroxycyclobutyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile (PubChem CID 137373955) has the molecular formula C14H13ClN4O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is 6-chloro-5-[1-[(1,3-dihydroxycyclobutyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile.
| Compound Name | 6-chloro-5-[1-[(1,3-dihydroxycyclobutyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 137373955 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 6-chloro-5-[1-[(1,3-dihydroxycyclobutyl)methyl]pyrazol-4-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(-c2cnn(CC3(O)CC(O)C3)c2)c(Cl)n1 |
| InChI | InChI=1S/C14H13ClN4O2/c15-13-12(2-1-10(5-16)18-13)9-6-17-19(7-9)8-14(21)3-11(20)4-14/h1-2,6-7,11,20-21H,3-4,8H2 |
| InChIKey | ILGFQNABXAGWKH-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|