C23H24FN3O2 — CID 137374269
methyl 5-[3-[1-[(1-fluorocyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]-2-methylbenzoate (PubChem CID 137374269) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is methyl 5-[3-[1-[(1-fluorocyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]-2-methylbenzoate.
| Compound Name | methyl 5-[3-[1-[(1-fluorocyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 137374269 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | methyl 5-[3-[1-[(1-fluorocyclopentyl)methyl]pyrazol-4-yl]-2-pyridinyl]-2-methylbenzoate |
| SMILES | COC(=O)c1cc(-c2ncccc2-c2cnn(CC3(F)CCCC3)c2)ccc1C |
| InChI | InChI=1S/C23H24FN3O2/c1-16-7-8-17(12-20(16)22(28)29-2)21-19(6-5-11-25-21)18-13-26-27(14-18)15-23(24)9-3-4-10-23/h5-8,11-14H,3-4,9-10,15H2,1-2H3 |
| InChIKey | CNBGTEXQCLTHQC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |