C20H14ClFN4O — CID 137375563
1-(3-chloro-2-fluorophenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide (PubChem CID 137375563) has the molecular formula C20H14ClFN4O and a molecular weight of 380.81 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 137375563 |
| Molecular Formula | C20H14ClFN4O |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc3ccccc3n2)cnn1-c1cccc(Cl)c1F |
| InChI | InChI=1S/C20H14ClFN4O/c1-12-14(11-23-26(12)17-8-4-6-15(21)19(17)22)20(27)25-18-10-9-13-5-2-3-7-16(13)24-18/h2-11H,1H3,(H,24,25,27) |
| InChIKey | OXQAGETYASBOBS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |