C22H20N4O — CID 137375541
1-(2-ethylphenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide (PubChem CID 137375541) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(2-ethylphenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 137375541 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 1-(2-ethylphenyl)-5-methyl-N-quinolin-2-ylpyrazole-4-carboxamide |
| SMILES | CCc1ccccc1-n1ncc(C(=O)Nc2ccc3ccccc3n2)c1C |
| InChI | InChI=1S/C22H20N4O/c1-3-16-8-5-7-11-20(16)26-15(2)18(14-23-26)22(27)25-21-13-12-17-9-4-6-10-19(17)24-21/h4-14H,3H2,1-2H3,(H,24,25,27) |
| InChIKey | AUVWZEGUEHUMBV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |