C25H21N3O2 — CID 68778884
2-ethyl-N-[3-(quinolin-2-ylcarbamoyl)phenyl]benzamide (PubChem CID 68778884) has the molecular formula C25H21N3O2 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-ethyl-N-[3-(quinolin-2-ylcarbamoyl)phenyl]benzamide.
| Compound Name | 2-ethyl-N-[3-(quinolin-2-ylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 68778884 |
| Molecular Formula | C25H21N3O2 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2-ethyl-N-[3-(quinolin-2-ylcarbamoyl)phenyl]benzamide |
| SMILES | CCc1ccccc1C(=O)Nc1cccc(C(=O)Nc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C25H21N3O2/c1-2-17-8-3-5-12-21(17)25(30)26-20-11-7-10-19(16-20)24(29)28-23-15-14-18-9-4-6-13-22(18)27-23/h3-16H,2H2,1H3,(H,26,30)(H,27,28,29) |
| InChIKey | IJPXZUIHFSJDSU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |