C10H4BrF3N2O3 — CID 137376105
1-(7-bromo-5-nitro-1H-indol-3-yl)-2,2,2-trifluoroethanone (PubChem CID 137376105) has the molecular formula C10H4BrF3N2O3 and a molecular weight of 337.05 g/mol. Its IUPAC name is 1-(7-bromo-5-nitro-1H-indol-3-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(7-bromo-5-nitro-1H-indol-3-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 137376105 |
| Molecular Formula | C10H4BrF3N2O3 |
| Molecular Weight | 337.05 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 1-(7-bromo-5-nitro-1H-indol-3-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1c[nH]c2c(Br)cc([N+](=O)[O-])cc12)C(F)(F)F |
| InChI | InChI=1S/C10H4BrF3N2O3/c11-7-2-4(16(18)19)1-5-6(3-15-8(5)7)9(17)10(12,13)14/h1-3,15H |
| InChIKey | DUTUDQMYDGWVDJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.05 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|