C11H7F3N2O3 — CID 59335033
2,2,2-trifluoro-1-(1-methyl-6-nitroindol-3-yl)ethanone (PubChem CID 59335033) has the molecular formula C11H7F3N2O3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-methyl-6-nitroindol-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(1-methyl-6-nitroindol-3-yl)ethanone |
|---|---|
| PubChem CID | 59335033 |
| Molecular Formula | C11H7F3N2O3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-methyl-6-nitroindol-3-yl)ethanone |
| SMILES | Cn1cc(C(=O)C(F)(F)F)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C11H7F3N2O3/c1-15-5-8(10(17)11(12,13)14)7-3-2-6(16(18)19)4-9(7)15/h2-5H,1H3 |
| InChIKey | WRMIGTAVYLRMLC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|