C41H28F6N4O5 — CID 161203408
1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;1-benzyl-6-nitro-3-(3,3,3-trifluoro-1-phenylprop-1-en-2-yl)indole (PubChem CID 161203408) has the molecular formula C41H28F6N4O5 and a molecular weight of 770.69 g/mol. Its IUPAC name is 1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;1-benzyl-6-nitro-3-(3,3,3-trifluoro-1-phenylprop-1-en-2-yl)indole.
| Compound Name | 1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;1-benzyl-6-nitro-3-(3,3,3-trifluoro-1-phenylprop-1-en-2-yl)indole |
|---|---|
| PubChem CID | 161203408 |
| Molecular Formula | C41H28F6N4O5 |
| Molecular Weight | 770.69 g/mol |
| Exact Mass | 770.20 |
| IUPAC Name | 1-(1-benzyl-6-nitroindol-3-yl)-2,2,2-trifluoroethanone;1-benzyl-6-nitro-3-(3,3,3-trifluoro-1-phenylprop-1-en-2-yl)indole |
| SMILES | O=C(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F.O=[N+]([O-])c1ccc2c(C(=Cc3ccccc3)C(F)(F)F)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C24H17F3N2O2.C17H11F3N2O3/c25-24(26,27)22(13-17-7-3-1-4-8-17)21-16-28(15-18-9-5-2-6-10-18)23-14-19(29(30)31)11-12-20(21)23;18-17(19,20)16(23)14-10-21(9-11-4-2-1-3-5-11)15-8-12(22(24)25)6-7-13(14)15/h1-14,16H,15H2;1-8,10H,9H2 |
| InChIKey | UVHAZDARFILDKO-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 113.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.69 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|