C20H21F3N4O3 — CID 59417848
3-(2-aminoethylamino)-2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 59417848) has the molecular formula C20H21F3N4O3 and a molecular weight of 422.41 g/mol. Its IUPAC name is 3-(2-aminoethylamino)-2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(2-aminoethylamino)-2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 59417848 |
| Molecular Formula | C20H21F3N4O3 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-(2-aminoethylamino)-2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | NCCNCC(O)(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F |
| InChI | InChI=1S/C20H21F3N4O3/c21-20(22,23)19(28,13-25-9-8-24)17-12-26(11-14-4-2-1-3-5-14)18-10-15(27(29)30)6-7-16(17)18/h1-7,10,12,25,28H,8-9,11,13,24H2 |
| InChIKey | BULCBOXXUOWMPN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|