C23H22F3N3O5 — CID 59417956
3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxy-1-morpholin-4-ylbutan-1-one (PubChem CID 59417956) has the molecular formula C23H22F3N3O5 and a molecular weight of 477.44 g/mol. Its IUPAC name is 3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxy-1-morpholin-4-ylbutan-1-one.
| Compound Name | 3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxy-1-morpholin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 59417956 |
| Molecular Formula | C23H22F3N3O5 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxy-1-morpholin-4-ylbutan-1-one |
| SMILES | O=C(CC(O)(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F)N1CCOCC1 |
| InChI | InChI=1S/C23H22F3N3O5/c24-23(25,26)22(31,13-21(30)27-8-10-34-11-9-27)19-15-28(14-16-4-2-1-3-5-16)20-12-17(29(32)33)6-7-18(19)20/h1-7,12,15,31H,8-11,13-14H2 |
| InChIKey | XCYHSEXCVGJHEB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|