C24H24F3N3O5 — CID 59417935
1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-2-carboxylic acid (PubChem CID 59417935) has the molecular formula C24H24F3N3O5 and a molecular weight of 491.47 g/mol. Its IUPAC name is 1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 59417935 |
| Molecular Formula | C24H24F3N3O5 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1CC(O)(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F |
| InChI | InChI=1S/C24H24F3N3O5/c25-24(26,27)23(33,15-28-11-5-4-8-20(28)22(31)32)19-14-29(13-16-6-2-1-3-7-16)21-12-17(30(34)35)9-10-18(19)21/h1-3,6-7,9-10,12,14,20,33H,4-5,8,11,13,15H2,(H,31,32) |
| InChIKey | URJPAIGOMDRVTK-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 108.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|