C24H26F3N5O4 — CID 59417830
4-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-N-methylpiperazine-1-carboxamide (PubChem CID 59417830) has the molecular formula C24H26F3N5O4 and a molecular weight of 505.50 g/mol. Its IUPAC name is 4-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-N-methylpiperazine-1-carboxamide.
| Compound Name | 4-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-N-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 59417830 |
| Molecular Formula | C24H26F3N5O4 |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 4-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-N-methylpiperazine-1-carboxamide |
| SMILES | CNC(=O)N1CCN(CC(O)(c2cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H26F3N5O4/c1-28-22(33)30-11-9-29(10-12-30)16-23(34,24(25,26)27)20-15-31(14-17-5-3-2-4-6-17)21-13-18(32(35)36)7-8-19(20)21/h2-8,13,15,34H,9-12,14,16H2,1H3,(H,28,33) |
| InChIKey | JPUCEBBRHQQFAV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|