C60H60F6N6O6 — CID 162078300
2-(1-benzyl-6-nitroindol-3-yl)-3-(4-benzylpiperidin-1-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 162078300) has the molecular formula C60H60F6N6O6 and a molecular weight of 1075.16 g/mol. Its IUPAC name is 2-(1-benzyl-6-nitroindol-3-yl)-3-(4-benzylpiperidin-1-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(1-benzyl-6-nitroindol-3-yl)-3-(4-benzylpiperidin-1-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 162078300 |
| Molecular Formula | C60H60F6N6O6 |
| Molecular Weight | 1075.16 g/mol |
| Exact Mass | 1074.45 |
| IUPAC Name | 2-(1-benzyl-6-nitroindol-3-yl)-3-(4-benzylpiperidin-1-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | O=[N+]([O-])c1ccc2c(C(O)(CN3CCC(Cc4ccccc4)CC3)C(F)(F)F)cn(Cc3ccccc3)c2c1.O=[N+]([O-])c1ccc2c(C(O)(CN3CCC(Cc4ccccc4)CC3)C(F)(F)F)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/2C30H30F3N3O3/c2*31-30(32,33)29(37,21-34-15-13-23(14-16-34)17-22-7-3-1-4-8-22)27-20-35(19-24-9-5-2-6-10-24)28-18-25(36(38)39)11-12-26(27)28/h2*1-12,18,20,23,37H,13-17,19,21H2 |
| InChIKey | ZBZQBRCWULLEAH-UHFFFAOYSA-N |
| XLogP | 12.60 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.16 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|