C34H36F3N3O7 — CID 91224626
ethyl 2-[3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-4-methoxyphenyl]acetate (PubChem CID 91224626) has the molecular formula C34H36F3N3O7 and a molecular weight of 655.67 g/mol. Its IUPAC name is ethyl 2-[3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-4-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-4-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 91224626 |
| Molecular Formula | C34H36F3N3O7 |
| Molecular Weight | 655.67 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | ethyl 2-[3-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-4-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC)c(OC2CCN(CC(O)(c3cn(Cc4ccccc4)c4cc([N+](=O)[O-])ccc34)C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C34H36F3N3O7/c1-3-46-32(41)18-24-9-12-30(45-2)31(17-24)47-26-13-15-38(16-14-26)22-33(42,34(35,36)37)28-21-39(20-23-7-5-4-6-8-23)29-19-25(40(43)44)10-11-27(28)29/h4-12,17,19,21,26,42H,3,13-16,18,20,22H2,1-2H3 |
| InChIKey | JYMQQPGIGUNNNK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.67 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|