C37H40F3N3O8 — CID 59418147
ethyl (E)-3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]azepan-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 59418147) has the molecular formula C37H40F3N3O8 and a molecular weight of 711.73 g/mol. Its IUPAC name is ethyl (E)-3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]azepan-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]azepan-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 59418147 |
| Molecular Formula | C37H40F3N3O8 |
| Molecular Weight | 711.73 g/mol |
| Exact Mass | 711.28 |
| IUPAC Name | ethyl (E)-3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]azepan-4-yl]oxy-3,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc(OC)c(OC2CCCN(CC(O)(c3cn(Cc4ccccc4)c4cc([N+](=O)[O-])ccc34)C(F)(F)F)CC2)c(OC)c1 |
| InChI | InChI=1S/C37H40F3N3O8/c1-4-50-34(44)15-12-26-19-32(48-2)35(33(20-26)49-3)51-28-11-8-17-41(18-16-28)24-36(45,37(38,39)40)30-23-42(22-25-9-6-5-7-10-25)31-21-27(43(46)47)13-14-29(30)31/h5-7,9-10,12-15,19-21,23,28,45H,4,8,11,16-18,22,24H2,1-3H3/b15-12+ |
| InChIKey | TUJDQATUYLQBRO-NTCAYCPXSA-N |
| XLogP | 6.87 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.73 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|