C35H38F3N3O7 — CID 59418048
ethyl 2-[4-[1-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybutyl]piperidin-4-yl]oxy-3-methoxyphenyl]acetate (PubChem CID 59418048) has the molecular formula C35H38F3N3O7 and a molecular weight of 669.70 g/mol. Its IUPAC name is ethyl 2-[4-[1-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybutyl]piperidin-4-yl]oxy-3-methoxyphenyl]acetate.
| Compound Name | ethyl 2-[4-[1-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybutyl]piperidin-4-yl]oxy-3-methoxyphenyl]acetate |
|---|---|
| PubChem CID | 59418048 |
| Molecular Formula | C35H38F3N3O7 |
| Molecular Weight | 669.70 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | ethyl 2-[4-[1-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybutyl]piperidin-4-yl]oxy-3-methoxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(OC2CCN(CCC(O)(c3cn(Cc4ccccc4)c4cc([N+](=O)[O-])ccc34)C(F)(F)F)CC2)c(OC)c1 |
| InChI | InChI=1S/C35H38F3N3O7/c1-3-47-33(42)20-25-9-12-31(32(19-25)46-2)48-27-13-16-39(17-14-27)18-15-34(43,35(36,37)38)29-23-40(22-24-7-5-4-6-8-24)30-21-26(41(44)45)10-11-28(29)30/h4-12,19,21,23,27,43H,3,13-18,20,22H2,1-2H3 |
| InChIKey | HTOSFAZAOVLPKZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.70 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|