C30H36F3N3O7 — CID 143434981
2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-hydroxy-2-[1-(2-methylbutyl)-6-nitroindol-3-yl]propyl]piperidin-4-yl]oxyphenyl]acetic acid (PubChem CID 143434981) has the molecular formula C30H36F3N3O7 and a molecular weight of 607.63 g/mol. Its IUPAC name is 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-hydroxy-2-[1-(2-methylbutyl)-6-nitroindol-3-yl]propyl]piperidin-4-yl]oxyphenyl]acetic acid.
| Compound Name | 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-hydroxy-2-[1-(2-methylbutyl)-6-nitroindol-3-yl]propyl]piperidin-4-yl]oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 143434981 |
| Molecular Formula | C30H36F3N3O7 |
| Molecular Weight | 607.63 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 2-[3-methoxy-4-[1-[3,3,3-trifluoro-2-hydroxy-2-[1-(2-methylbutyl)-6-nitroindol-3-yl]propyl]piperidin-4-yl]oxyphenyl]acetic acid |
| SMILES | CCC(C)Cn1cc(C(O)(CN2CCC(Oc3ccc(CC(=O)O)cc3OC)CC2)C(F)(F)F)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C30H36F3N3O7/c1-4-19(2)16-35-17-24(23-7-6-21(36(40)41)15-25(23)35)29(39,30(31,32)33)18-34-11-9-22(10-12-34)43-26-8-5-20(14-28(37)38)13-27(26)42-3/h5-8,13,15,17,19,22,39H,4,9-12,14,16,18H2,1-3H3,(H,37,38) |
| InChIKey | BNNIVGFFNKGLCX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|