C39H43F3N4O8 — CID 68703042
ethyl 1-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3-methoxybenzoyl]piperidine-4-carboxylate (PubChem CID 68703042) has the molecular formula C39H43F3N4O8 and a molecular weight of 752.79 g/mol. Its IUPAC name is ethyl 1-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3-methoxybenzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3-methoxybenzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 68703042 |
| Molecular Formula | C39H43F3N4O8 |
| Molecular Weight | 752.79 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | ethyl 1-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]oxy-3-methoxybenzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccc(OC3CCN(CC(O)(c4cn(Cc5ccccc5)c5cc([N+](=O)[O-])ccc45)C(F)(F)F)CC3)c(OC)c2)CC1 |
| InChI | InChI=1S/C39H43F3N4O8/c1-3-53-37(48)27-13-19-44(20-14-27)36(47)28-9-12-34(35(21-28)52-2)54-30-15-17-43(18-16-30)25-38(49,39(40,41)42)32-24-45(23-26-7-5-4-6-8-26)33-22-29(46(50)51)10-11-31(32)33/h4-12,21-22,24,27,30,49H,3,13-20,23,25H2,1-2H3 |
| InChIKey | ORZZNMKARCZRKU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 136.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|