C30H28F3N3O4 — CID 59418077
[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]-phenylmethanone (PubChem CID 59418077) has the molecular formula C30H28F3N3O4 and a molecular weight of 551.57 g/mol. Its IUPAC name is [1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 59418077 |
| Molecular Formula | C30H28F3N3O4 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | [1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]piperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(CC(O)(c2cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C30H28F3N3O4/c31-30(32,33)29(38,20-34-15-13-23(14-16-34)28(37)22-9-5-2-6-10-22)26-19-35(18-21-7-3-1-4-8-21)27-17-24(36(39)40)11-12-25(26)27/h1-12,17,19,23,38H,13-16,18,20H2 |
| InChIKey | VHGHFBRRSQGHPG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|