C33H32F3N3O8 — CID 59418165
3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]oxy-3-methoxyphenyl]propanoic acid (PubChem CID 59418165) has the molecular formula C33H32F3N3O8 and a molecular weight of 655.63 g/mol. Its IUPAC name is 3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]oxy-3-methoxyphenyl]propanoic acid.
| Compound Name | 3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]oxy-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 59418165 |
| Molecular Formula | C33H32F3N3O8 |
| Molecular Weight | 655.63 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | 3-[4-[1-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropanoyl]piperidin-4-yl]oxy-3-methoxyphenyl]propanoic acid |
| SMILES | COc1cc(CCC(=O)O)ccc1OC1CCN(C(=O)C(O)(c2cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)CC1 |
| InChI | InChI=1S/C33H32F3N3O8/c1-46-29-17-21(8-12-30(40)41)7-11-28(29)47-24-13-15-37(16-14-24)31(42)32(43,33(34,35)36)26-20-38(19-22-5-3-2-4-6-22)27-18-23(39(44)45)9-10-25(26)27/h2-7,9-11,17-18,20,24,43H,8,12-16,19H2,1H3,(H,40,41) |
| InChIKey | IWPVTMDYBIHBLI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 144.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.63 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|