C25H22F3N3O4 — CID 59418100
2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(2-methoxyanilino)propan-2-ol (PubChem CID 59418100) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(2-methoxyanilino)propan-2-ol.
| Compound Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(2-methoxyanilino)propan-2-ol |
|---|---|
| PubChem CID | 59418100 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(2-methoxyanilino)propan-2-ol |
| SMILES | COc1ccccc1NCC(O)(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F |
| InChI | InChI=1S/C25H22F3N3O4/c1-35-23-10-6-5-9-21(23)29-16-24(32,25(26,27)28)20-15-30(14-17-7-3-2-4-8-17)22-13-18(31(33)34)11-12-19(20)22/h2-13,15,29,32H,14,16H2,1H3 |
| InChIKey | XMGGFZVZHKIKNT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|