C26H24F3N3O3 — CID 59418170
2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(1-phenylethylamino)propan-2-ol (PubChem CID 59418170) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(1-phenylethylamino)propan-2-ol.
| Compound Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(1-phenylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 59418170 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-(1-phenylethylamino)propan-2-ol |
| SMILES | CC(NCC(O)(c1cn(Cc2ccccc2)c2cc([N+](=O)[O-])ccc12)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C26H24F3N3O3/c1-18(20-10-6-3-7-11-20)30-17-25(33,26(27,28)29)23-16-31(15-19-8-4-2-5-9-19)24-14-21(32(34)35)12-13-22(23)24/h2-14,16,18,30,33H,15,17H2,1H3 |
| InChIKey | FQRZEPXVUSNGGG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|