C34H34F3N3O7 — CID 59418161
ethyl (E)-3-[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-5,7-dimethoxy-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enoate (PubChem CID 59418161) has the molecular formula C34H34F3N3O7 and a molecular weight of 653.65 g/mol. Its IUPAC name is ethyl (E)-3-[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-5,7-dimethoxy-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-5,7-dimethoxy-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59418161 |
| Molecular Formula | C34H34F3N3O7 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | ethyl (E)-3-[2-[2-(1-benzyl-6-nitroindol-3-yl)-3,3,3-trifluoro-2-hydroxypropyl]-5,7-dimethoxy-3,4-dihydro-1H-isoquinolin-6-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(OC)cc2c(c1OC)CCN(CC(O)(c1cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc13)C(F)(F)F)C2 |
| InChI | InChI=1S/C34H34F3N3O7/c1-4-47-31(41)13-12-27-30(45-2)16-23-19-38(15-14-25(23)32(27)46-3)21-33(42,34(35,36)37)28-20-39(18-22-8-6-5-7-9-22)29-17-24(40(43)44)10-11-26(28)29/h5-13,16-17,20,42H,4,14-15,18-19,21H2,1-3H3/b13-12+ |
| InChIKey | FDZNRAPNXGCLTH-OUKQBFOZSA-N |
| XLogP | 6.00 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|