C28H21F3N2O5 — CID 59417957
ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybut-1-ynyl]benzoate (PubChem CID 59417957) has the molecular formula C28H21F3N2O5 and a molecular weight of 522.48 g/mol. Its IUPAC name is ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybut-1-ynyl]benzoate.
| Compound Name | ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybut-1-ynyl]benzoate |
|---|---|
| PubChem CID | 59417957 |
| Molecular Formula | C28H21F3N2O5 |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | ethyl 4-[3-(1-benzyl-6-nitroindol-3-yl)-4,4,4-trifluoro-3-hydroxybut-1-ynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#CC(O)(c2cn(Cc3ccccc3)c3cc([N+](=O)[O-])ccc23)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H21F3N2O5/c1-2-38-26(34)21-10-8-19(9-11-21)14-15-27(35,28(29,30)31)24-18-32(17-20-6-4-3-5-7-20)25-16-22(33(36)37)12-13-23(24)25/h3-13,16,18,35H,2,17H2,1H3 |
| InChIKey | QGQCGUYBUWKCDN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|