C31H25F3N2O4 — CID 59417800
ethyl 4-[3-(1-benzyl-6-isocyanoindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate (PubChem CID 59417800) has the molecular formula C31H25F3N2O4 and a molecular weight of 546.55 g/mol. Its IUPAC name is ethyl 4-[3-(1-benzyl-6-isocyanoindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate.
| Compound Name | ethyl 4-[3-(1-benzyl-6-isocyanoindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate |
|---|---|
| PubChem CID | 59417800 |
| Molecular Formula | C31H25F3N2O4 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | ethyl 4-[3-(1-benzyl-6-isocyanoindol-3-yl)-4,4,4-trifluoro-3-(methoxymethoxy)but-1-ynyl]benzoate |
| SMILES | [C-]#[N+]c1ccc2c(C(C#Cc3ccc(C(=O)OCC)cc3)(OCOC)C(F)(F)F)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C31H25F3N2O4/c1-4-39-29(37)24-12-10-22(11-13-24)16-17-30(31(32,33)34,40-21-38-3)27-20-36(19-23-8-6-5-7-9-23)28-18-25(35-2)14-15-26(27)28/h5-15,18,20H,4,19,21H2,1,3H3 |
| InChIKey | FIDJBOMVPVYHAX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 54.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|