C17H18IN5O — CID 137376170
2-[3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)indol-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 137376170) has the molecular formula C17H18IN5O and a molecular weight of 435.27 g/mol. Its IUPAC name is 2-[3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)indol-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)indol-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 137376170 |
| Molecular Formula | C17H18IN5O |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 2-[3-iodo-5-(1-methyl-1,2,4-triazol-3-yl)indol-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | Cn1cnc(-c2ccc3c(c2)c(I)cn3CC(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C17H18IN5O/c1-21-11-19-17(20-21)12-4-5-15-13(8-12)14(18)9-23(15)10-16(24)22-6-2-3-7-22/h4-5,8-9,11H,2-3,6-7,10H2,1H3 |
| InChIKey | DMAOJHYWZVWOPX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|