C28H32ClN5O6 — CID 137376562
N-hydroxy-4-[[4-methyl-14-(2-morpholin-4-ium-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzamide chloride (PubChem CID 137376562) has the molecular formula C28H32ClN5O6 and a molecular weight of 570.05 g/mol. Its IUPAC name is N-hydroxy-4-[[4-methyl-14-(2-morpholin-4-ium-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzamide chloride.
| Compound Name | N-hydroxy-4-[[4-methyl-14-(2-morpholin-4-ium-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzamide chloride |
|---|---|
| PubChem CID | 137376562 |
| Molecular Formula | C28H32ClN5O6 |
| Molecular Weight | 570.05 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | N-hydroxy-4-[[4-methyl-14-(2-morpholin-4-ium-4-ylethoxy)-3,5-dioxo-4,6,10-triazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),11(16),12,14-tetraen-10-yl]methyl]benzamide chloride |
| SMILES | CN1C(=O)C2c3c(n(Cc4ccc(C(=O)NO)cc4)c4ccc(OCC[NH+]5CCOCC5)cc34)CCN2C1=O.[Cl-] |
| InChI | InChI=1S/C28H31N5O6.ClH/c1-30-27(35)25-24-21-16-20(39-15-12-31-10-13-38-14-11-31)6-7-22(21)33(23(24)8-9-32(25)28(30)36)17-18-2-4-19(5-3-18)26(34)29-37;/h2-7,16,25,37H,8-15,17H2,1H3,(H,29,34);1H |
| InChIKey | GOQUOGHEOSDTEC-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.05 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|