C30H35F4N5O4 — CID 137377209
(1-methylcyclobutyl) 3-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 137377209) has the molecular formula C30H35F4N5O4 and a molecular weight of 605.63 g/mol. Its IUPAC name is (1-methylcyclobutyl) 3-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | (1-methylcyclobutyl) 3-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 137377209 |
| Molecular Formula | C30H35F4N5O4 |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | (1-methylcyclobutyl) 3-[2-fluoro-5-[[6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carbonyl]amino]-4-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | C[C@@H]1CN(c2cc(F)c(C3=CCN(C(=O)OC4(C)CCC4)C3)cc2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C30H35F4N5O4/c1-17-14-39(15-18(2)37(17)4)25-12-23(31)20(19-6-9-38(16-19)28(42)43-29(3)7-5-8-29)10-24(25)36-27(41)21-13-35-26(40)11-22(21)30(32,33)34/h6,10-13,17-18H,5,7-9,14-16H2,1-4H3,(H,35,40)(H,36,41)/t17-,18+ |
| InChIKey | IBJJWBJQAZQVSN-HDICACEKSA-N |
| XLogP | 5.09 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|