C29H30F4N4O4 — CID 137377467
N-[5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide (PubChem CID 137377467) has the molecular formula C29H30F4N4O4 and a molecular weight of 574.58 g/mol. Its IUPAC name is N-[5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide.
| Compound Name | N-[5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 137377467 |
| Molecular Formula | C29H30F4N4O4 |
| Molecular Weight | 574.58 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | N-[5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-4-fluoro-2-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3ccc4c(c3)OCCCO4)cc2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C29H30F4N4O4/c1-16-14-37(15-17(2)36(16)3)24-12-22(30)19(18-5-6-25-26(9-18)41-8-4-7-40-25)10-23(24)35-28(39)20-13-34-27(38)11-21(20)29(31,32)33/h5-6,9-13,16-17H,4,7-8,14-15H2,1-3H3,(H,34,38)(H,35,39)/t16-,17+ |
| InChIKey | AAPWIOPMOZQGGE-CALCHBBNSA-N |
| XLogP | 5.14 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |