C14H16F2N2O3 — CID 137378044
(4R)-3-[3,5-difluoro-4-(3-hydroxypropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 137378044) has the molecular formula C14H16F2N2O3 and a molecular weight of 298.29 g/mol. Its IUPAC name is (4R)-3-[3,5-difluoro-4-(3-hydroxypropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | (4R)-3-[3,5-difluoro-4-(3-hydroxypropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 137378044 |
| Molecular Formula | C14H16F2N2O3 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (4R)-3-[3,5-difluoro-4-(3-hydroxypropoxy)phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | C[C@@H]1CC(=O)NN=C1c1cc(F)c(OCCCO)c(F)c1 |
| InChI | InChI=1S/C14H16F2N2O3/c1-8-5-12(20)17-18-13(8)9-6-10(15)14(11(16)7-9)21-4-2-3-19/h6-8,19H,2-5H2,1H3,(H,17,20)/t8-/m1/s1 |
| InChIKey | HMORTVOKNVUBTB-MRVPVSSYSA-N |
| XLogP | 1.59 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|