C15H16F2N2O3 — CID 137378096
3-[2,3-difluoro-4-[(Z)-4-hydroxybut-2-enoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 137378096) has the molecular formula C15H16F2N2O3 and a molecular weight of 310.30 g/mol. Its IUPAC name is 3-[2,3-difluoro-4-[(Z)-4-hydroxybut-2-enoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[2,3-difluoro-4-[(Z)-4-hydroxybut-2-enoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 137378096 |
| Molecular Formula | C15H16F2N2O3 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-[2,3-difluoro-4-[(Z)-4-hydroxybut-2-enoxy]phenyl]-4-methyl-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CC1CC(=O)NN=C1c1ccc(OC/C=C\CO)c(F)c1F |
| InChI | InChI=1S/C15H16F2N2O3/c1-9-8-12(21)18-19-15(9)10-4-5-11(14(17)13(10)16)22-7-3-2-6-20/h2-5,9,20H,6-8H2,1H3,(H,18,21)/b3-2- |
| InChIKey | HXGPUBZILREMCU-IHWYPQMZSA-N |
| XLogP | 1.75 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|