C21H24N4O2 — CID 137378369
4-[[1-(2-cyclopentylethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide (PubChem CID 137378369) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-[[1-(2-cyclopentylethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[1-(2-cyclopentylethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 137378369 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-[[1-(2-cyclopentylethyl)benzimidazol-2-yl]amino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Nc2nc3ccccc3n2CCC2CCCC2)cc1 |
| InChI | InChI=1S/C21H24N4O2/c26-20(24-27)16-9-11-17(12-10-16)22-21-23-18-7-3-4-8-19(18)25(21)14-13-15-5-1-2-6-15/h3-4,7-12,15,27H,1-2,5-6,13-14H2,(H,22,23)(H,24,26) |
| InChIKey | SPYJQWGNNZBTIL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|