C23H23N5O — CID 88993158
N-(2-aminophenyl)-4-[(1-propylbenzimidazol-2-yl)amino]benzamide (PubChem CID 88993158) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(1-propylbenzimidazol-2-yl)amino]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(1-propylbenzimidazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 88993158 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-(2-aminophenyl)-4-[(1-propylbenzimidazol-2-yl)amino]benzamide |
| SMILES | CCCn1c(Nc2ccc(C(=O)Nc3ccccc3N)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H23N5O/c1-2-15-28-21-10-6-5-9-20(21)27-23(28)25-17-13-11-16(12-14-17)22(29)26-19-8-4-3-7-18(19)24/h3-14H,2,15,24H2,1H3,(H,25,27)(H,26,29) |
| InChIKey | QCXFQTXJWHRYNY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|