C15H9ClF3N3 — CID 137378416
6-chloro-N-[4-(trifluoromethyl)-2-pyridinyl]quinolin-2-amine (PubChem CID 137378416) has the molecular formula C15H9ClF3N3 and a molecular weight of 323.71 g/mol. Its IUPAC name is 6-chloro-N-[4-(trifluoromethyl)-2-pyridinyl]quinolin-2-amine.
| Compound Name | 6-chloro-N-[4-(trifluoromethyl)-2-pyridinyl]quinolin-2-amine |
|---|---|
| PubChem CID | 137378416 |
| Molecular Formula | C15H9ClF3N3 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 6-chloro-N-[4-(trifluoromethyl)-2-pyridinyl]quinolin-2-amine |
| SMILES | FC(F)(F)c1ccnc(Nc2ccc3cc(Cl)ccc3n2)c1 |
| InChI | InChI=1S/C15H9ClF3N3/c16-11-2-3-12-9(7-11)1-4-13(21-12)22-14-8-10(5-6-20-14)15(17,18)19/h1-8H,(H,20,21,22) |
| InChIKey | WASHWXCWDGIPIH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |