C9H11N5 — CID 137381769
1-(1H-indazol-5-yl)-2-methylguanidine (PubChem CID 137381769) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 1-(1H-indazol-5-yl)-2-methylguanidine.
| Compound Name | 1-(1H-indazol-5-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 137381769 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-(1H-indazol-5-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C9H11N5/c1-11-9(10)13-7-2-3-8-6(4-7)5-12-14-8/h2-5H,1H3,(H,12,14)(H3,10,11,13) |
| InChIKey | NULPRLDJSVHDPC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|