C10H11N3O3 — CID 79346712
2-hydroxyethyl N-(1H-indazol-5-yl)carbamate (PubChem CID 79346712) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-hydroxyethyl N-(1H-indazol-5-yl)carbamate.
| Compound Name | 2-hydroxyethyl N-(1H-indazol-5-yl)carbamate |
|---|---|
| PubChem CID | 79346712 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-hydroxyethyl N-(1H-indazol-5-yl)carbamate |
| SMILES | O=C(Nc1ccc2[nH]ncc2c1)OCCO |
| InChI | InChI=1S/C10H11N3O3/c14-3-4-16-10(15)12-8-1-2-9-7(5-8)6-11-13-9/h1-2,5-6,14H,3-4H2,(H,11,13)(H,12,15) |
| InChIKey | LGPOBKPKDQQDEC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |