C11H16N2 — CID 137382786
1,2-dimethyl-1-[(E)-3-phenylprop-2-enyl]hydrazine (PubChem CID 137382786) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(E)-3-phenylprop-2-enyl]hydrazine.
| Compound Name | 1,2-dimethyl-1-[(E)-3-phenylprop-2-enyl]hydrazine |
|---|---|
| PubChem CID | 137382786 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,2-dimethyl-1-[(E)-3-phenylprop-2-enyl]hydrazine |
| SMILES | CNN(C)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C11H16N2/c1-12-13(2)10-6-9-11-7-4-3-5-8-11/h3-9,12H,10H2,1-2H3/b9-6+ |
| InChIKey | HDZGFYBZKMJFJS-RMKNXTFCSA-N |
| XLogP | 1.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|