C58H42F3N15 — CID 137386441
2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 137386441) has the molecular formula C58H42F3N15 and a molecular weight of 1006.07 g/mol. Its IUPAC name is 2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 137386441 |
| Molecular Formula | C58H42F3N15 |
| Molecular Weight | 1006.07 g/mol |
| Exact Mass | 1005.37 |
| IUPAC Name | 2,5-bis[3,6-bis(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-4-[2-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1nc(C)nc(-c2ccc3c(c2)c2cc(-c4nc(C)nc(C)n4)ccc2n3-c2cc(-c3ccccc3C(F)(F)F)c(-n3c4ccc(-c5nc(C)nc(C)n5)cc4c4cc(-c5nc(C)nc(C)n5)ccc43)cc2C#N)n1 |
| InChI | InChI=1S/C58H42F3N15/c1-28-63-29(2)68-54(67-28)36-13-17-48-42(21-36)43-22-37(55-69-30(3)64-31(4)70-55)14-18-49(43)75(48)52-26-46(41-11-9-10-12-47(41)58(59,60)61)53(25-40(52)27-62)76-50-19-15-38(56-71-32(5)65-33(6)72-56)23-44(50)45-24-39(16-20-51(45)76)57-73-34(7)66-35(8)74-57/h9-26H,1-8H3 |
| InChIKey | BIDQZPDYRZIGNP-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 188.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.07 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |