C14H23N — CID 137390997
3-(2,4-dimethylphenyl)-N,N-dimethylbutan-2-amine (PubChem CID 137390997) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N,N-dimethylbutan-2-amine.
| Compound Name | 3-(2,4-dimethylphenyl)-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 137390997 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N,N-dimethylbutan-2-amine |
| SMILES | Cc1ccc(C(C)C(C)N(C)C)c(C)c1 |
| InChI | InChI=1S/C14H23N/c1-10-7-8-14(11(2)9-10)12(3)13(4)15(5)6/h7-9,12-13H,1-6H3 |
| InChIKey | INASQALYOWCNIF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |