C27H26FN9 — CID 137393052
2-[1-[(5-butyl-2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine (PubChem CID 137393052) has the molecular formula C27H26FN9 and a molecular weight of 495.57 g/mol. Its IUPAC name is 2-[1-[(5-butyl-2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine.
| Compound Name | 2-[1-[(5-butyl-2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 137393052 |
| Molecular Formula | C27H26FN9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 2-[1-[(5-butyl-2-fluorophenyl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine |
| SMILES | CCCCc1ccc(F)c(Cn2nc(-c3nc(N)c(/N=N/c4ccccc4)c(N)n3)c3cccnc32)c1 |
| InChI | InChI=1S/C27H26FN9/c1-2-3-8-17-12-13-21(28)18(15-17)16-37-27-20(11-7-14-31-27)22(36-37)26-32-24(29)23(25(30)33-26)35-34-19-9-5-4-6-10-19/h4-7,9-15H,2-3,8,16H2,1H3,(H4,29,30,32,33)/b35-34+ |
| InChIKey | BXMZPWRYTSGRMR-XAHDOWKMSA-N |
| XLogP | 6.00 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|