C23H15F2N9 — CID 126724022
2-[5-fluoro-1-[(6-fluorocyclohexa-1,5-dien-3-yn-1-yl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine (PubChem CID 126724022) has the molecular formula C23H15F2N9 and a molecular weight of 455.43 g/mol. Its IUPAC name is 2-[5-fluoro-1-[(6-fluorocyclohexa-1,5-dien-3-yn-1-yl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine.
| Compound Name | 2-[5-fluoro-1-[(6-fluorocyclohexa-1,5-dien-3-yn-1-yl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 126724022 |
| Molecular Formula | C23H15F2N9 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[5-fluoro-1-[(6-fluorocyclohexa-1,5-dien-3-yn-1-yl)methyl]pyrazolo[5,4-b]pyridin-3-yl]-5-phenyldiazenylpyrimidine-4,6-diamine |
| SMILES | Nc1nc(-c2nn(Cc3cc#ccc3F)c3ncc(F)cc23)nc(N)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C23H15F2N9/c24-14-10-16-18(33-34(23(16)28-11-14)12-13-6-4-5-9-17(13)25)22-29-20(26)19(21(27)30-22)32-31-15-7-2-1-3-8-15/h1-3,6-11H,12H2,(H4,26,27,29,30)/b32-31+ |
| InChIKey | OKUJLYDHZWPBQW-QNEJGDQOSA-N |
| XLogP | 4.39 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|