C22H26FN2O4P — CID 137397611
1-[1-[[5-(2-fluoro-2-phosphanylethoxy)-2-(2-methylpropoxy)phenyl]methyl]indazol-5-yl]-2-hydroxyethanone (PubChem CID 137397611) has the molecular formula C22H26FN2O4P and a molecular weight of 432.43 g/mol. Its IUPAC name is 1-[1-[[5-(2-fluoro-2-phosphanylethoxy)-2-(2-methylpropoxy)phenyl]methyl]indazol-5-yl]-2-hydroxyethanone.
| Compound Name | 1-[1-[[5-(2-fluoro-2-phosphanylethoxy)-2-(2-methylpropoxy)phenyl]methyl]indazol-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 137397611 |
| Molecular Formula | C22H26FN2O4P |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 1-[1-[[5-(2-fluoro-2-phosphanylethoxy)-2-(2-methylpropoxy)phenyl]methyl]indazol-5-yl]-2-hydroxyethanone |
| SMILES | CC(C)COc1ccc(OCC(F)P)cc1Cn1ncc2cc(C(=O)CO)ccc21 |
| InChI | InChI=1S/C22H26FN2O4P/c1-14(2)12-29-21-6-4-18(28-13-22(23)30)8-17(21)10-25-19-5-3-15(20(27)11-26)7-16(19)9-24-25/h3-9,14,22,26H,10-13,30H2,1-2H3 |
| InChIKey | IBUPJPDJGUPZTI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|