C26H36N2O4Si — CID 86690439
methyl 1-[[5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropoxy)phenyl]methyl]indazole-5-carboxylate (PubChem CID 86690439) has the molecular formula C26H36N2O4Si and a molecular weight of 468.67 g/mol. Its IUPAC name is methyl 1-[[5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropoxy)phenyl]methyl]indazole-5-carboxylate.
| Compound Name | methyl 1-[[5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropoxy)phenyl]methyl]indazole-5-carboxylate |
|---|---|
| PubChem CID | 86690439 |
| Molecular Formula | C26H36N2O4Si |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | methyl 1-[[5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropoxy)phenyl]methyl]indazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(cnn2Cc2cc(O[Si](C)(C)C(C)(C)C)ccc2OCC(C)C)c1 |
| InChI | InChI=1S/C26H36N2O4Si/c1-18(2)17-31-24-12-10-22(32-33(7,8)26(3,4)5)14-21(24)16-28-23-11-9-19(25(29)30-6)13-20(23)15-27-28/h9-15,18H,16-17H2,1-8H3 |
| InChIKey | PEUXWMNFCTZRHO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|