C27H31N — CID 137397980
N-[2-(4-tert-butylcyclohexa-1,5-dien-1-yl)propan-2-yl]phenanthren-2-amine (PubChem CID 137397980) has the molecular formula C27H31N and a molecular weight of 369.55 g/mol. Its IUPAC name is N-[2-(4-tert-butylcyclohexa-1,5-dien-1-yl)propan-2-yl]phenanthren-2-amine.
| Compound Name | N-[2-(4-tert-butylcyclohexa-1,5-dien-1-yl)propan-2-yl]phenanthren-2-amine |
|---|---|
| PubChem CID | 137397980 |
| Molecular Formula | C27H31N |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-[2-(4-tert-butylcyclohexa-1,5-dien-1-yl)propan-2-yl]phenanthren-2-amine |
| SMILES | CC(C)(Nc1ccc2c(ccc3ccccc32)c1)C1=CCC(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C27H31N/c1-26(2,3)21-12-14-22(15-13-21)27(4,5)28-23-16-17-25-20(18-23)11-10-19-8-6-7-9-24(19)25/h6-12,14-18,21,28H,13H2,1-5H3 |
| InChIKey | NNZFTYQUILGYHO-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|