C16H22ClN3O3 — CID 137399054
N-[2-[[2-(4-chlorophenoxy)acetyl]amino]-1-ethylcyclopropyl]-2-(methylamino)acetamide (PubChem CID 137399054) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenoxy)acetyl]amino]-1-ethylcyclopropyl]-2-(methylamino)acetamide.
| Compound Name | N-[2-[[2-(4-chlorophenoxy)acetyl]amino]-1-ethylcyclopropyl]-2-(methylamino)acetamide |
|---|---|
| PubChem CID | 137399054 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[2-[[2-(4-chlorophenoxy)acetyl]amino]-1-ethylcyclopropyl]-2-(methylamino)acetamide |
| SMILES | CCC1(NC(=O)CNC)CC1NC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClN3O3/c1-3-16(20-14(21)9-18-2)8-13(16)19-15(22)10-23-12-6-4-11(17)5-7-12/h4-7,13,18H,3,8-10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | CROSLRXPMUEORQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |