C29H39N5 — CID 137400670
6-methyl-9-[(4-methylphenyl)methyl]-12-(2-methylpropyl)-13-(2-phenylethyl)-4,6,7,10,13-pentazatricyclo[8.3.0.03,7]trideca-1,3-diene (PubChem CID 137400670) has the molecular formula C29H39N5 and a molecular weight of 457.67 g/mol. Its IUPAC name is 6-methyl-9-[(4-methylphenyl)methyl]-12-(2-methylpropyl)-13-(2-phenylethyl)-4,6,7,10,13-pentazatricyclo[8.3.0.03,7]trideca-1,3-diene.
| Compound Name | 6-methyl-9-[(4-methylphenyl)methyl]-12-(2-methylpropyl)-13-(2-phenylethyl)-4,6,7,10,13-pentazatricyclo[8.3.0.03,7]trideca-1,3-diene |
|---|---|
| PubChem CID | 137400670 |
| Molecular Formula | C29H39N5 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | 6-methyl-9-[(4-methylphenyl)methyl]-12-(2-methylpropyl)-13-(2-phenylethyl)-4,6,7,10,13-pentazatricyclo[8.3.0.03,7]trideca-1,3-diene |
| SMILES | Cc1ccc(CC2CN3C(=NCN3C)C=C3N(CCc4ccccc4)C(CC(C)C)CN32)cc1 |
| InChI | InChI=1S/C29H39N5/c1-22(2)16-26-19-33-27(17-25-12-10-23(3)11-13-25)20-34-28(30-21-31(34)4)18-29(33)32(26)15-14-24-8-6-5-7-9-24/h5-13,18,22,26-27H,14-17,19-21H2,1-4H3 |
| InChIKey | CDIPEWXWSOAJPP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |