C34H40N4O — CID 132531430
4-[[(5R,8R,11R)-8-benzyl-4-(2-phenylethyl)-11-propan-2-yl-4,7,10,13-tetrazatricyclo[8.3.0.03,7]trideca-1(13),2-dien-5-yl]methyl]phenol (PubChem CID 132531430) has the molecular formula C34H40N4O and a molecular weight of 520.72 g/mol. Its IUPAC name is 4-[[(5R,8R,11R)-8-benzyl-4-(2-phenylethyl)-11-propan-2-yl-4,7,10,13-tetrazatricyclo[8.3.0.03,7]trideca-1(13),2-dien-5-yl]methyl]phenol.
| Compound Name | 4-[[(5R,8R,11R)-8-benzyl-4-(2-phenylethyl)-11-propan-2-yl-4,7,10,13-tetrazatricyclo[8.3.0.03,7]trideca-1(13),2-dien-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 132531430 |
| Molecular Formula | C34H40N4O |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 4-[[(5R,8R,11R)-8-benzyl-4-(2-phenylethyl)-11-propan-2-yl-4,7,10,13-tetrazatricyclo[8.3.0.03,7]trideca-1(13),2-dien-5-yl]methyl]phenol |
| SMILES | CC(C)[C@@H]1CN=C2C=C3N(CCc4ccccc4)[C@H](Cc4ccc(O)cc4)CN3[C@H](Cc3ccccc3)CN21 |
| InChI | InChI=1S/C34H40N4O/c1-25(2)32-22-35-33-21-34-36(18-17-26-9-5-3-6-10-26)29(20-28-13-15-31(39)16-14-28)23-37(34)30(24-38(32)33)19-27-11-7-4-8-12-27/h3-16,21,25,29-30,32,39H,17-20,22-24H2,1-2H3/t29-,30-,32+/m1/s1 |
| InChIKey | JJDYDYIGQQPOAJ-FUWNPBJGSA-N |
| XLogP | 5.37 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |