C21H23F3N2O3 — CID 137401835
4-[[(3aS,4R)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]oxymethyl]-5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole (PubChem CID 137401835) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-[[(3aS,4R)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]oxymethyl]-5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole.
| Compound Name | 4-[[(3aS,4R)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]oxymethyl]-5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 137401835 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-[[(3aS,4R)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-4-yl]oxymethyl]-5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazole |
| SMILES | FC(F)(F)Oc1ccccc1-c1noc(C2CC2)c1CO[C@@H]1CCC2CNC[C@H]21 |
| InChI | InChI=1S/C21H23F3N2O3/c22-21(23,24)28-18-4-2-1-3-14(18)19-16(20(29-26-19)12-5-6-12)11-27-17-8-7-13-9-25-10-15(13)17/h1-4,12-13,15,17,25H,5-11H2/t13?,15-,17-/m1/s1 |
| InChIKey | IBIWOQOKMPDVIQ-RJPUVWTNSA-N |
| XLogP | 4.63 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |